ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
상품명칭 |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
영문 이름 |
4-amino-2,3,5,6-tetrafluorobenzoic acid; |
분자식 |
C7H3F4NO2 |
분자량 |
209.0978 |
InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
cas번호 |
944-43-4 |
EC번호 |
213-409-6 |
분자 구조 |
|
밀도 |
1.726g/cm3 |
녹는 점 |
185-187℃ |
비등점 |
283.6°C at 760 mmHg |
굴절 지수 |
1.529 |
인화점 |
125.3°C |
증기압 |
0.00148mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|