959-22-8 4-Nitrophenyl benzoate
상품명칭 |
4-Nitrophenyl benzoate |
영문 이름 |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
분자식 |
C13H9NO4 |
분자량 |
243.2149 |
InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
cas번호 |
959-22-8 |
분자 구조 |
|
밀도 |
1.316g/cm3 |
비등점 |
399.5°C at 760 mmHg |
굴절 지수 |
1.614 |
인화점 |
183.5°C |
증기압 |
1.37E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|