959-23-9 4'-Methoxychalcone
상품명칭 |
4'-Methoxychalcone |
영문 이름 |
4'-Methoxychalcone; 4'-Methoxychalcone; AI3-25493; CCRIS 2231; EINECS 213-495-5; NSC 37157; 2-Propen-1-one, 1-(4-methoxyphenyl)-3-phenyl-; alpha-Styryl p-anisyl ketone; 1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one |
분자식 |
C16H14O2 |
분자량 |
238.2812 |
InChI |
InChI=1/C16H14O2/c1-18-15-10-8-14(9-11-15)16(17)12-7-13-5-3-2-4-6-13/h2-12H,1H3/b12-7+ |
cas번호 |
959-23-9 |
EC번호 |
213-495-5 |
분자 구조 |
|
밀도 |
1.114g/cm3 |
녹는 점 |
101-103℃ |
비등점 |
397.48°C at 760 mmHg |
굴절 지수 |
1.606 |
인화점 |
180.482°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|