ChemNet > CAS > 96784-54-2 3-Methyl-4-nitrobenzonitrile
96784-54-2 3-Methyl-4-nitrobenzonitrile
상품명칭 |
3-Methyl-4-nitrobenzonitrile |
영문 이름 |
3-Methyl-4-nitrobenzonitrile; 4-Nitro-m-tolunitrile;
|
분자식 |
C8H6N2O2 |
분자량 |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
cas번호 |
96784-54-2 |
분자 구조 |
|
밀도 |
1.26g/cm3 |
녹는 점 |
82-83℃ |
비등점 |
322.2°C at 760 mmHg |
굴절 지수 |
1.568 |
인화점 |
148.6°C |
증기압 |
0.000284mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|