ChemNet > CAS > 98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
| 상품명칭 |
4-bromo-2-chlorophenyl isothiocyanate |
| 영문 이름 |
4-bromo-2-chlorophenyl isothiocyanate; 4-Bromo-2-chloroisothiocyanatobenzene; 1-bromo-2-chloro-4-isothiocyanatobenzene; 4-bromo-2-chloro-1-isothiocyanatobenzene |
| 분자식 |
C7H3BrClNS |
| 분자량 |
248.5274 |
| InChI |
InChI=1/C7H3BrClNS/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| cas번호 |
98041-69-1 |
| 분자 구조 |
|
| 밀도 |
1.63g/cm3 |
| 녹는 점 |
46-48℃ |
| 비등점 |
315.2°C at 760 mmHg |
| 굴절 지수 |
1.641 |
| 인화점 |
144.4°C |
| 증기압 |
0.000823mmHg at 25°C |
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|