ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
| 상품명칭 |
Diallyl maleate |
| 영문 이름 |
Diallyl maleate; Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
| 분자식 |
C10H12O4 |
| 분자량 |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
| cas번호 |
999-21-3 |
| EC번호 |
213-658-0 |
| 분자 구조 |
|
| 밀도 |
1.064g/cm3 |
| 비등점 |
263.7°C at 760 mmHg |
| 굴절 지수 |
1.469 |
| 인화점 |
124.6°C |
| 증기압 |
0.0101mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
