2642-98-0 6-Aminochrysene 6-Aminochrysene

Synonyms： 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine
CAS Number：2642-98-0
EINECS：220-149-7
Molecular Formula：C₁₈H₁₃N
Molecular Weight：243.3025
InChI：InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2
Molecular Structure：
Density：1.253g/cm³
Melting point：206-211℃
Boiling point：501.2°C at 760 mmHg
Refractive index：1.813
Flash point：286.9°C
Vapour Pressur：3.56E-10mmHg at 25°C
Hazard Symbols: Xn:Harmful;
Risk Codes：
Safety Description： S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;