341-02-6 Triphenylcarbenium tetrafluoroborate Triphenylcarbenium tetrafluoroborate

Synonyms： Trityl fluoroborate; Tritylium tetrafluoroborate; Trityl tetrafluoroborate; triphenylmethylium tetrafluoroborate
CAS Number：341-02-6
EINECS：206-433-3
Molecular Formula：C₁₉H₁₅BF₄
Molecular Weight：330.127
InChI：InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1
Molecular Structure：
Melting point：205-215℃
Hazard Symbols: C:Corrosive;
Risk Codes： R34:Causes burns.;
Safety Description： S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;