34688-70-5 Pentamethylphenylacetonitrile Pentamethylphenylacetonitrile

Synonyms： 2,3,4,5,6-Pentamethylbenzyl cyanide
CAS Number：34688-70-5
Molecular Formula：C₁₃H₁₇N
Molecular Weight：187.2808
InChI：InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3
Molecular Structure：
Density：0.95g/cm³
Melting point：105-107℃
Boiling point：325.9°C at 760 mmHg
Refractive index：1.519
Flash point：160.2°C
Vapour Pressur：0.000224mmHg at 25°C
Hazard Symbols:
Risk Codes： R20/22:Harmful by inhalation and if swallowed.;
Safety Description： S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;