36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid 2,5-Dichlorothiophene-3-carboxylic acid

Synonyms： 2,5-Dichloro-3-Thiopheneformic Acid; 2,5-dichlorothiophene-3-carboxylate
CAS Number：36157-41-2
Molecular Formula：C₅HCl₂O₂S
Molecular Weight：196.0318
InChI：InChI=1/C5H2Cl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)/p-1
Molecular Structure：
Boiling point：296.6°C at 760 mmHg
Flash point：133.2°C
Vapour Pressur：0.000641mmHg at 25°C
Hazard Symbols:
Risk Codes： R36/37/38:Irritating to eyes, respiratory system and skin.;
Safety Description： S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;