402-64-2 3-fluorobenzal chloride 3-fluorobenzal chloride

Synonyms： alpha,alpha-Dichloro-3-fluorotoluene
CAS Number：402-64-2
EINECS：206-952-5
Molecular Formula：C₇H₅Cl₂F
Molecular Weight： 179.02
InChI：InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H
Molecular Structure：
Boiling point：195℃
Hazard Symbols:
Risk Codes： R34:Causes burns.;
R36:Irritating to eyes.;
Safety Description： S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;