45019-28-1 4-Methylnonanoic acid 4-Methylnonanoic acid

Synonyms： Nonanoic acid, 4-methyl-; 4-Methylpelargonic acid; AI3-30047; FEMA No. 3574; 4-Methylnonan-1-oic acid; (4R)-4-methylnonanoate; (4S)-4-methylnonanoate
CAS Number：45019-28-1
EINECS：256-180-8
Molecular Formula：C₁₀H₁₉O₂
Molecular Weight：171.2572
InChI：InChI=1/C10H20O2/c1-3-4-5-6-9(2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)/p-1/t9-/m0/s1
Molecular Structure：
Boiling point：271.6°C at 760 mmHg
Flash point：142.3°C
Vapour Pressur：0.00178mmHg at 25°C
Hazard Symbols:
Risk Codes： R36/38:Irritating to eyes and skin.;
Safety Description： S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;