68412-48-6 2-Propanone, reaction products with diphenylamine 2-Propanone, reaction products with diphenylamine

Synonyms：Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W; Anti-oxidant agent BLE-W
CAS Number：68412-48-6
EINECS：270-192-0
Molecular Formula：C₁₅H₁₇NO
Molecular Weight：227.3016
InChI：InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3
Molecular Structure：
Boiling point：302°C at 760 mmHg
Flash point：152.8°C
Vapour Pressur：0.00102mmHg at 25°C
Hazard Symbols:
Risk Codes：
Safety Description：