92-32-0 Pyronin Y Pyronin Y

Synonyms： C.I. 45005; Pyronine; Pyronin G; PYRONINE G; pyronin Y molecular biology; Pyronin Y, CI 45005; Pyronine Y; N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride
CAS Number：92-32-0
EINECS：202-147-8
Molecular Formula：C₁₇H₁₉ClN₂O
Molecular Weight：302.7986
InChI：InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1
Molecular Structure：
Melting point：250-260℃
Hazard Symbols: Xn:Harmful;
Risk Codes：
Safety Description： S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;