ChemNet > CAS > 1004-66-6 2,6-Dimethylanisole
1004-66-6 2,6-Dimethylanisole
| Nama produk |
2,6-Dimethylanisole |
| Nama Inggeris |
2,6-Dimethylanisole; 1,3-Dimethyl-2-methoxybenzene; 2,6-Dimethylanisone; 2-Methoxy-m-xylene; 2-methoxy-1,3-dimethyl-benzene |
| MF |
C9H12O |
| Berat Molekul |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-5-4-6-8(2)9(7)10-3/h4-6H,1-3H3 |
| CAS NO |
1004-66-6 |
| EINECS |
213-723-3 |
| Struktur Molekul |
|
| Kepadatan |
0.932g/cm3 |
| Titik didih |
181°C at 760 mmHg |
| Indeks bias |
1.495 |
| Titik nyala |
67.2°C |
| Tekanan wap |
1.18mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
