101-99-5 N-Phenylurethane
Nama produk |
N-Phenylurethane |
Nama Inggeris |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
MF |
C9H11NO2 |
Berat Molekul |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
CAS NO |
101-99-5 |
EINECS |
202-995-9 |
Struktur Molekul |
|
Kepadatan |
1.136g/cm3 |
Titik didih |
238°C at 760 mmHg |
Indeks bias |
1.558 |
Titik nyala |
79.2°C |
Tekanan wap |
0.0434mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R40:Possible risks of irreversible effects.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|