102-85-2 Tributyl phosphite
Nama produk |
Tributyl phosphite |
Nama Inggeris |
Tributyl phosphite; Tri-n-butyl phosphite |
MF |
C12H27O3P |
Berat Molekul |
250.3147 |
InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
CAS NO |
102-85-2 |
EINECS |
203-061-3 |
Struktur Molekul |
|
Titik lebur |
-80℃ |
Titik didih |
268.1°C at 760 mmHg |
Titik nyala |
121.1°C |
Tekanan wap |
0.013mmHg at 25°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|