105-61-3 N-Carbamoylmaleamic acid
Nama produk |
N-Carbamoylmaleamic acid |
Nama Inggeris |
N-Carbamoylmaleamic acid; Maleuric acid; Maleic acid monoureide~Maleuric acid; (2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid; (2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid; 4-(carbamoylamino)-4-oxobut-2-enoate |
MF |
C5H5N2O4 |
Berat Molekul |
157.1047 |
InChI |
InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
CAS NO |
105-61-3 |
EINECS |
203-314-8 |
Struktur Molekul |
|
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|