ChemNet > CAS > 107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
Nama produk |
2,3,5,6-Tetrafluorobenzoyl chloride |
Nama Inggeris |
2,3,5,6-Tetrafluorobenzoyl chloride; |
MF |
C7HClF4O |
Berat Molekul |
212.5289 |
InChI |
InChI=1/C7HClF4O/c8-7(13)4-5(11)2(9)1-3(10)6(4)12/h1H |
CAS NO |
107535-73-9 |
Struktur Molekul |
|
Kepadatan |
1.601g/cm3 |
Titik didih |
172.1°C at 760 mmHg |
Indeks bias |
1.461 |
Titik nyala |
57.9°C |
Tekanan wap |
1.35mmHg at 25°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|