ChemNet > CAS > 110-36-1 butyl myristate
110-36-1 butyl myristate
| Nama produk |
butyl myristate |
| Nama Inggeris |
butyl myristate; n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
| MF |
C18H36O2 |
| Berat Molekul |
284.4772 |
| InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
| CAS NO |
110-36-1 |
| EINECS |
203-759-8 |
| Struktur Molekul |
|
| Kepadatan |
0.864g/cm3 |
| Titik didih |
334.7°C at 760 mmHg |
| Indeks bias |
1.442 |
| Titik nyala |
158.5°C |
| Tekanan wap |
0.000126mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
