| Nama produk |
2,4,7-trinitro-9H-fluoren-9-one - 3,4,7-trimethyl-1-benzothiophene (1:1) |
| Sinonim |
; 2,4,7-Trinitrofluoren-9-one compd.dengan 3,4,7-trimethylbenzo(b)thiophene (1:1); Fluoren-9-satu, 2,4,7-trinitro-, compd.dengan 3,4,7-trimethylbenzo(b)thiophene (1:1) |
| Nama Inggeris |
2,4,7-trinitro-9H-fluoren-9-one - 3,4,7-trimethyl-1-benzothiophene (1:1); 2,4,7-Trinitrofluoren-9-one compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1); Fluoren-9-one, 2,4,7-trinitro-, compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1) |
| MF |
C24H17N3O7S |
| Berat Molekul |
491.4727 |
| InChI |
InChI=1/C13H5N3O7.C11H12S/c17-13-9-3-6(14(18)19)1-2-8(9)12-10(13)4-7(15(20)21)5-11(12)16(22)23;1-7-4-5-8(2)11-10(7)9(3)6-12-11/h1-5H;4-6H,1-3H3 |
| CAS NO |
1108-42-5 |
| Struktur Molekul |
|
| Titik didih |
561.7°C at 760 mmHg |
| Titik nyala |
292.3°C |
| Tekanan wap |
1.2E-12mmHg at 25°C |
|