1121-24-0 2-Hydroxythiophenol
Nama produk |
2-Hydroxythiophenol |
Nama Inggeris |
2-Hydroxythiophenol; 2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
MF |
C6H6OS |
Berat Molekul |
126.1762 |
InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
CAS NO |
1121-24-0 |
EINECS |
214-326-8 |
Struktur Molekul |
|
Kepadatan |
1.255g/cm3 |
Titik didih |
223.7°C at 760 mmHg |
Indeks bias |
1.642 |
Titik nyala |
89.1°C |
Tekanan wap |
0.0636mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|