ChemNet > CAS > 114686-85-0 2,3-Dichlorophenethylalcohol
114686-85-0 2,3-Dichlorophenethylalcohol
Nama produk |
2,3-Dichlorophenethylalcohol |
Nama Inggeris |
2,3-Dichlorophenethylalcohol;2-(2,3-dichlorophenyl)ethanol |
MF |
C8H8Cl2O |
Berat Molekul |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3,11H,4-5H2 |
CAS NO |
114686-85-0 |
Struktur Molekul |
|
Kepadatan |
1.329g/cm3 |
Titik didih |
279.1°C at 760 mmHg |
Indeks bias |
1.569 |
Titik nyala |
117.9°C |
Tekanan wap |
0.00196mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|