ChemNet > CAS > 117-18-0 2,3,5,6-Tetrachloronitrobenzene
117-18-0 2,3,5,6-Tetrachloronitrobenzene
| Nama produk |
2,3,5,6-Tetrachloronitrobenzene |
| Nama Inggeris |
2,3,5,6-Tetrachloronitrobenzene; 1,2,4,5-Tetrachloro-3-nitrobenzene; tecnazene; 3-Nitro-1,2,4,5-tetrachlorobenzene; Tecnazene; 1,2,3,4,5-pentachloro-6-nitrobenzene; 1,2,3,4-Tetrachloro-3-Nitrobenzene; Fumite(R); Fusarex(R); LABOTEST-BB LT00152717 |
| MF |
C6HCl4NO2 |
| Berat Molekul |
260.8896 |
| InChI |
InChI=1/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| CAS NO |
117-18-0 |
| EINECS |
204-178-2 |
| Struktur Molekul |
|
| Kepadatan |
1.75g/cm3 |
| Titik lebur |
98-101℃ |
| Titik didih |
304°C at 760 mmHg |
| Indeks bias |
1.62 |
| Titik nyala |
143.1°C |
| Tekanan wap |
0.00162mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| Kod Risiko |
R22:Harmful if swallowed.;
R43:May cause sensitization by skin contact.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Keselamatan Penerangan |
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
