ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
Nama produk |
3,5-Dibromobenzeneboronic acid |
Nama Inggeris |
3,5-Dibromobenzeneboronic acid; 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
MF |
C6H5BBr2O2 |
Berat Molekul |
279.7217 |
InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
CAS NO |
117695-55-3 |
Struktur Molekul |
|
Kepadatan |
2.09g/cm3 |
Titik lebur |
300℃ |
Titik didih |
382.8°C at 760 mmHg |
Indeks bias |
1.651 |
Titik nyala |
185.3°C |
Tekanan wap |
1.52E-06mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|