ChemNet > CAS > 1187-34-4 etil N-(2-cyano-3-ethoxyacryloyl)carbamate
1187-34-4 etil N-(2-cyano-3-ethoxyacryloyl)carbamate
| Nama produk |
etil N-(2-cyano-3-ethoxyacryloyl)carbamate |
| Sinonim |
etil [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| Nama Inggeris |
ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate;ethyl [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| MF |
C9H12N2O4 |
| Berat Molekul |
212.2026 |
| InChI |
InChI=1/C9H12N2O4/c1-3-14-6-7(5-10)8(12)11-9(13)15-4-2/h6H,3-4H2,1-2H3,(H,11,12,13)/b7-6+ |
| CAS NO |
1187-34-4 |
| Struktur Molekul |
|
| Kepadatan |
1.181g/cm3 |
| Titik lebur |
116℃ |
| Indeks bias |
1.476 |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
