ChemNet > CAS > 1194-66-7 2,6-Dichloronitrosobenzene
1194-66-7 2,6-Dichloronitrosobenzene
| Nama produk |
2,6-Dichloronitrosobenzene |
| Nama Inggeris |
2,6-Dichloronitrosobenzene;1,3-dichloro-2-nitrosobenzene |
| MF |
C6H3Cl2NO |
| Berat Molekul |
176.0001 |
| InChI |
InChI=1/C6H3Cl2NO/c7-4-2-1-3-5(8)6(4)9-10/h1-3H |
| CAS NO |
1194-66-7 |
| Struktur Molekul |
|
| Kepadatan |
1.45g/cm3 |
| Titik didih |
271.9°C at 760 mmHg |
| Indeks bias |
1.588 |
| Titik nyala |
120.5°C |
| Tekanan wap |
0.0105mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
