ChemNet > CAS > 1195-09-1 3-Hydroxy-4-methoxytoluene
1195-09-1 3-Hydroxy-4-methoxytoluene
| Nama produk |
3-Hydroxy-4-methoxytoluene |
| Nama Inggeris |
3-Hydroxy-4-methoxytoluene; 2-Methoxy-5-methylphenol; Isocreosol~5-Methylguaiacol |
| MF |
C8H10O2 |
| Berat Molekul |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-6-3-4-8(10-2)7(9)5-6/h3-5,9H,1-2H3 |
| CAS NO |
1195-09-1 |
| EINECS |
214-791-7 |
| Struktur Molekul |
|
| Kepadatan |
1.078g/cm3 |
| Titik didih |
226.4°C at 760 mmHg |
| Indeks bias |
1.53 |
| Titik nyala |
99°C |
| Tekanan wap |
0.0546mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
