ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
| Nama produk |
4-(Dimethylamino)benzonitrile |
| Nama Inggeris |
4-(Dimethylamino)benzonitrile; 4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
| MF |
C9H10N2 |
| Berat Molekul |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| CAS NO |
1197-19-9 |
| EINECS |
214-819-8 |
| Struktur Molekul |
|
| Kepadatan |
1.04g/cm3 |
| Titik lebur |
70-76℃ |
| Titik didih |
318.8°C at 760 mmHg |
| Indeks bias |
1.55 |
| Titik nyala |
145.4°C |
| Tekanan wap |
0.000353mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
