1210-33-9 5-Chlorodibenzosuberane
Nama produk |
5-Chlorodibenzosuberane |
Nama Inggeris |
5-Chlorodibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene; 5-Chlorobenzosuberane; 5H-Dibenzo[a,d]cycloheptene, 5-chloro-10,11-dihydro-; 5-chloro-10,11-dihydro-5H-dibenzo[a,d][7]annulene; 5-Chloro dibenzosuberane; Dibenzosuberyl chloride; 5-Chloro dibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene |
MF |
C15H13Cl |
Berat Molekul |
228.7167 |
InChI |
InChI=1/C15H13Cl/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15H,9-10H2 |
CAS NO |
1210-33-9 |
EINECS |
214-910-2 |
Struktur Molekul |
|
Kepadatan |
1.19g/cm3 |
Titik didih |
321.738°C at 760 mmHg |
Indeks bias |
1.627 |
Titik nyala |
136.593°C |
Tekanan wap |
0.001mmHg at 25°C |
Cinta bahaya |
34:;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|