ChemNet > CAS > 1211-35-4 2-(4-chlorophenyl)-1H-indole
1211-35-4 2-(4-chlorophenyl)-1H-indole
| Nama produk |
2-(4-chlorophenyl)-1H-indole |
| Nama Inggeris |
2-(4-chlorophenyl)-1H-indole; 2-(4-Chlorophenyl)indole |
| MF |
C14H10ClN |
| Berat Molekul |
227.6889 |
| InChI |
InChI=1/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H |
| CAS NO |
1211-35-4 |
| Struktur Molekul |
|
| Kepadatan |
1.271g/cm3 |
| Titik didih |
417.8°C at 760 mmHg |
| Indeks bias |
1.684 |
| Titik nyala |
239°C |
| Tekanan wap |
8.36E-07mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
