ChemNet > CAS > 132898-95-4 2,2'-bithiophene-5-asid boronic
132898-95-4 2,2'-bithiophene-5-asid boronic
| Nama produk |
2,2'-bithiophene-5-asid boronic |
| Sinonim |
2,2'-bithiophen-5-asid ylboronic |
| Nama Inggeris |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
| MF |
C8H7BO2S2 |
| Berat Molekul |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| CAS NO |
132898-95-4 |
| Struktur Molekul |
|
| Kepadatan |
1.42g/cm3 |
| Titik lebur |
127℃ |
| Titik didih |
416.1°C at 760 mmHg |
| Indeks bias |
1.658 |
| Titik nyala |
205.5°C |
| Tekanan wap |
1.14E-07mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
