ChemNet > CAS > 13321-74-9 1-bromo-2,5-dimethoxy-4-methylbenzene
13321-74-9 1-bromo-2,5-dimethoxy-4-methylbenzene
| Nama produk |
1-bromo-2,5-dimethoxy-4-methylbenzene |
| Nama Inggeris |
1-bromo-2,5-dimethoxy-4-methylbenzene; |
| MF |
C9H11BrO2 |
| Berat Molekul |
231.0864 |
| InChI |
InChI=1/C9H11BrO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| CAS NO |
13321-74-9 |
| Struktur Molekul |
|
| Kepadatan |
1.36g/cm3 |
| Titik lebur |
77℃ |
| Titik didih |
270.4°C at 760 mmHg |
| Indeks bias |
1.525 |
| Titik nyala |
114.1°C |
| Tekanan wap |
0.0114mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|