ChemNet > CAS > 135145-90-3 2,5-Dichlorobenzeneboronic acid
135145-90-3 2,5-Dichlorobenzeneboronic acid
Nama produk |
2,5-Dichlorobenzeneboronic acid |
Nama Inggeris |
2,5-Dichlorobenzeneboronic acid; 2,5-Dichlorophenylboronic acid |
MF |
C6H5BCl2O2 |
Berat Molekul |
190.8197 |
InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
CAS NO |
135145-90-3 |
Struktur Molekul |
|
Kepadatan |
1.47g/cm3 |
Titik lebur |
150℃ |
Titik didih |
343.6°C at 760 mmHg |
Indeks bias |
1.577 |
Titik nyala |
161.6°C |
Tekanan wap |
2.65E-05mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|