ChemNet > CAS > 135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
Nama produk |
2,4,6-Trimethoxybenzeneboronic acid |
Nama Inggeris |
2,4,6-Trimethoxybenzeneboronic acid; 2,4,6-Trimethoxyphenylboronic acid |
MF |
C9H13BO5 |
Berat Molekul |
212.0075 |
InChI |
InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
CAS NO |
135159-25-0 |
Struktur Molekul |
|
Kepadatan |
1.21g/cm3 |
Titik didih |
413.8°C at 760 mmHg |
Indeks bias |
1.513 |
Titik nyala |
204.1°C |
Tekanan wap |
1.37E-07mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|