ChemNet > CAS > 13589-72-5 5-chloro-2-hydroxybenzonitrile
13589-72-5 5-chloro-2-hydroxybenzonitrile
| Nama produk |
5-chloro-2-hydroxybenzonitrile |
| Nama Inggeris |
5-chloro-2-hydroxybenzonitrile; |
| MF |
C7H4ClNO |
| Berat Molekul |
153.5658 |
| InChI |
InChI=1/C7H4ClNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H |
| CAS NO |
13589-72-5 |
| Struktur Molekul |
|
| Kepadatan |
1.41g/cm3 |
| Titik lebur |
152℃ |
| Titik didih |
269.4°C at 760 mmHg |
| Indeks bias |
1.611 |
| Titik nyala |
116.7°C |
| Tekanan wap |
0.00438mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
