ChemNet > CAS > 13631-21-5 4-Bromo-3-chlorophenol
13631-21-5 4-Bromo-3-chlorophenol
| Nama produk |
4-Bromo-3-chlorophenol |
| Nama Inggeris |
4-Bromo-3-chlorophenol; |
| MF |
C6H4BrClO |
| Berat Molekul |
207.4524 |
| InChI |
InChI=1/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| CAS NO |
13631-21-5 |
| Struktur Molekul |
|
| Kepadatan |
1.788g/cm3 |
| Titik didih |
267.5°C at 760 mmHg |
| Indeks bias |
1.619 |
| Titik nyala |
115.6°C |
| Tekanan wap |
0.00493mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
