ChemNet > CAS > 13679-73-7 2-Acetyl-4-methylthiophene
13679-73-7 2-Acetyl-4-methylthiophene
| Nama produk |
2-Acetyl-4-methylthiophene |
| Nama Inggeris |
2-Acetyl-4-methylthiophene;1-(4-Methyl-2-thienyl)ethan-1-one; AI3-61742; Ethanone, 1-(4-methyl-2-thienyl)-; 1-(4-methylthiophen-2-yl)ethanone |
| MF |
C7H8OS |
| Berat Molekul |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
| CAS NO |
13679-73-7 |
| EINECS |
237-180-7 |
| Struktur Molekul |
|
| Kepadatan |
1.106g/cm3 |
| Titik didih |
236.9°C at 760 mmHg |
| Indeks bias |
1.535 |
| Titik nyala |
97.1°C |
| Tekanan wap |
0.0461mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
