ChemNet > CAS > 144284-25-3 2,4,5-trifluorobenzyl alcohol
144284-25-3 2,4,5-trifluorobenzyl alcohol
Nama produk |
2,4,5-trifluorobenzyl alcohol |
Nama Inggeris |
2,4,5-trifluorobenzyl alcohol; (2,4,5-trifluorophenyl)methanol |
MF |
C7H5F3O |
Berat Molekul |
162.11 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
CAS NO |
144284-25-3 |
Struktur Molekul |
|
Kepadatan |
1.858g/cm3 |
Titik didih |
213.308°C at 760 mmHg |
Indeks bias |
1.55 |
Titik nyala |
82.806°C |
Tekanan wap |
0.113mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|