ChemNet > CAS > 14444-77-0 Diethyl phenyl orthoformate
14444-77-0 Diethyl phenyl orthoformate
| Nama produk |
Diethyl phenyl orthoformate |
| Nama Inggeris |
Diethyl phenyl orthoformate; Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
| MF |
C11H16O3 |
| Berat Molekul |
196.2429 |
| InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| CAS NO |
14444-77-0 |
| EINECS |
238-421-9 |
| Struktur Molekul |
|
| Kepadatan |
1.019g/cm3 |
| Titik didih |
235.2°C at 760 mmHg |
| Indeks bias |
1.482 |
| Titik nyala |
57.2°C |
| Tekanan wap |
0.0777mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
