ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
Nama produk |
2,3-difluorophenylacetonitrile |
Nama Inggeris |
2,3-difluorophenylacetonitrile; 2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
MF |
C8H5F2N |
Berat Molekul |
153.1288 |
InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
CAS NO |
145689-34-5 |
Struktur Molekul |
|
Kepadatan |
1.234g/cm3 |
Titik didih |
216.9°C at 760 mmHg |
Indeks bias |
1.487 |
Titik nyala |
85°C |
Tekanan wap |
0.136mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|