ChemNet > CAS > 1459-00-3 beta-Bromoisopropylbenzene
1459-00-3 beta-Bromoisopropylbenzene
Nama produk |
beta-Bromoisopropylbenzene |
Nama Inggeris |
beta-Bromoisopropylbenzene; 1-Bromo-2-phenylpropane; beta-Bromocumene; 2-Phenylpropyl bromide; [(2S)-1-bromopropan-2-yl]benzene; β-Bromoisopropylbenzene |
MF |
C9H11Br |
Berat Molekul |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/t8-/m1/s1 |
CAS NO |
1459-00-3 |
EINECS |
215-948-2 |
Struktur Molekul |
|
Kepadatan |
1.303g/cm3 |
Titik didih |
188.5°C at 760 mmHg |
Indeks bias |
1.543 |
Titik nyala |
85.9°C |
Tekanan wap |
0.825mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|