1492-30-4 4-nitrophenyl palmitate
Nama produk |
4-nitrophenyl palmitate |
Nama Inggeris |
4-nitrophenyl palmitate; 4-Nitrophenyl hexadecanoate; Palmitic acid 4-nitrophenyl ester; 4-Nitrophenol palmitate |
MF |
C22H35NO4 |
Berat Molekul |
377.5176 |
InChI |
InChI=1/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(24)27-21-18-16-20(17-19-21)23(25)26/h16-19H,2-15H2,1H3 |
CAS NO |
1492-30-4 |
EINECS |
216-084-9 |
Struktur Molekul |
|
Kepadatan |
1.02g/cm3 |
Titik lebur |
60℃ |
Titik didih |
483.6°C at 760 mmHg |
Indeks bias |
1.5 |
Titik nyala |
160.7°C |
Tekanan wap |
1.66E-09mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|