ChemNet > CAS > 15217-53-5 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol
15217-53-5 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol
| Nama produk |
1-ethyl-1H-1,2,3,4-tetraazole-5-thiol |
| Nama Inggeris |
1-ethyl-1H-1,2,3,4-tetraazole-5-thiol; 1-Ethyl-5-mercaptotetrazole; 1-ETHYL-5-MERCAPTO-1H-TETRAZOLE; 1-ETHYL-1H-TETRAZOLE-5-THIOL; 1-ethyl-1,2-dihydro-5h-tetrazole-5-thione; 1-ETHYL-1H-1,2,3,4-TETRAZOLE-5-THIOL; 1-Ethyl-5-mercapto-1,2,3,4-tetrazole; 1-ETHYL-1,4-DIHYDRO-TETRAZOLE-5-THIONE |
| MF |
C3H6N4S |
| Berat Molekul |
130.1715 |
| InChI |
InChI=1/C3H6N4S/c1-2-7-3(8)4-5-6-7/h2H2,1H3,(H,4,6,8) |
| CAS NO |
15217-53-5 |
| EINECS |
239-270-1 |
| Struktur Molekul |
|
| Kepadatan |
1.53g/cm3 |
| Titik didih |
136.4°C at 760 mmHg |
| Indeks bias |
1.737 |
| Titik nyala |
36.3°C |
| Tekanan wap |
7.4mmHg at 25°C |
| Cinta bahaya |
 C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
