1539-04-4 Diphenyl tere-phthalate
| Nama produk |
Diphenyl tere-phthalate |
| Nama Inggeris |
Diphenyl tere-phthalate; Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
| MF |
C20H14O4 |
| Berat Molekul |
318.3228 |
| InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
| CAS NO |
1539-04-4 |
| EINECS |
216-264-7 |
| Struktur Molekul |
|
| Kepadatan |
1.242g/cm3 |
| Titik lebur |
197-199℃ |
| Titik didih |
496.6°C at 760 mmHg |
| Indeks bias |
1.615 |
| Titik nyala |
255°C |
| Tekanan wap |
5.34E-10mmHg at 25°C |
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|