ChemNet > CAS > 1583-59-1 2,2-Difluoro-1,3-benzodioxole
1583-59-1 2,2-Difluoro-1,3-benzodioxole
Nama produk |
2,2-Difluoro-1,3-benzodioxole |
Nama Inggeris |
2,2-Difluoro-1,3-benzodioxole; 1,2-[(Difluoromethylene)dioxy]benzene; 2,2-difluorobenzo[d][1,3]dioxole; 2,2-Difluorobenzodioxole; 2,2-Difluoro-2H-1,3-benzodioxole; 2,2-Difluoro-13-benzodioxole |
MF |
C7H4F2O2 |
Berat Molekul |
158.1023 |
InChI |
InChI=1/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
CAS NO |
1583-59-1 |
EINECS |
216-431-4 |
Struktur Molekul |
|
Kepadatan |
1.42g/cm3 |
Titik didih |
125.1°C at 760 mmHg |
Indeks bias |
1.509 |
Titik nyala |
35.1°C |
Tekanan wap |
15mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|