ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
| Nama produk |
Cyclohexanone 2,4-dinitrophenylhydrazone |
| Nama Inggeris |
Cyclohexanone 2,4-dinitrophenylhydrazone;Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
| MF |
C12H14N4O4 |
| Berat Molekul |
278.264 |
| InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
| CAS NO |
1589-62-4 |
| EINECS |
216-458-1 |
| Struktur Molekul |
|
| Kepadatan |
1.47g/cm3 |
| Titik lebur |
159-161℃ |
| Titik didih |
434.6°C at 760 mmHg |
| Indeks bias |
1.665 |
| Titik nyala |
216.7°C |
| Tekanan wap |
9.33E-08mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
