ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
| Nama produk |
3-Chloro-4-fluorobenzyl alcohol |
| Nama Inggeris |
3-Chloro-4-fluorobenzyl alcohol; (3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
| MF |
C7H6ClFO |
| Berat Molekul |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
| CAS NO |
161446-90-8 |
| Struktur Molekul |
|
| Kepadatan |
1.344g/cm3 |
| Titik didih |
242.5°C at 760 mmHg |
| Indeks bias |
1.542 |
| Titik nyala |
100.4°C |
| Tekanan wap |
0.0183mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
