ChemNet > CAS > 16215-21-7 Butyl 3-mercaptopropionate
16215-21-7 Butyl 3-mercaptopropionate
| Nama produk |
Butyl 3-mercaptopropionate |
| Nama Inggeris |
Butyl 3-mercaptopropionate; Propanoic acid, 3-mercapto-, butyl ester; Butyl mercaptopropionate; NSC 54830; beta-Mercaptopropionic acid, butyl ester; Propionic acid, 3-mercapto-, butyl ester; butyl 3-sulfanylpropanoate |
| MF |
C7H14O2S |
| Berat Molekul |
162.2499 |
| InChI |
InChI=1/C7H14O2S/c1-2-3-5-9-7(8)4-6-10/h10H,2-6H2,1H3 |
| CAS NO |
16215-21-7 |
| EINECS |
240-343-5 |
| Struktur Molekul |
|
| Kepadatan |
1.003g/cm3 |
| Titik didih |
216.9°C at 760 mmHg |
| Indeks bias |
1.458 |
| Titik nyala |
93.3°C |
| Tekanan wap |
0.136mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
