ChemNet > CAS > 1643-15-8 (m-Tolyloxy)-acetic acid
1643-15-8 (m-Tolyloxy)-acetic acid
Nama produk |
(m-Tolyloxy)-acetic acid |
Nama Inggeris |
(m-Tolyloxy)-acetic acid; 3-Methylphenoxyacetic acid; (3-methylphenoxy)acetic acid; (3-methylphenoxy)acetate |
MF |
C9H9O3 |
Berat Molekul |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
CAS NO |
1643-15-8 |
EINECS |
216-698-7 |
Struktur Molekul |
|
Titik didih |
300°C at 760 mmHg |
Titik nyala |
121.4°C |
Tekanan wap |
0.000512mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|